C14H16N4 — CID 7358769
cis-(3S,4E,6R)-6-ethyl-4-ethylidene-2-imino-6-methylcyclohexane-1,1,3-tricarbonitrile (PubChem CID 7358769) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is cis-(3S,4E,6R)-6-ethyl-4-ethylidene-2-imino-6-methylcyclohexane-1,1,3-tricarbonitrile.
| Compound Name | cis-(3S,4E,6R)-6-ethyl-4-ethylidene-2-imino-6-methylcyclohexane-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 7358769 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | cis-(3S,4E,6R)-6-ethyl-4-ethylidene-2-imino-6-methylcyclohexane-1,1,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)/C(=C/C)C[C@@](C)(CC)C1(C#N)C#N |
| InChI | InChI=1S/C14H16N4/c1-4-10-6-13(3,5-2)14(8-16,9-17)12(18)11(10)7-15/h4,11,18H,5-6H2,1-3H3/b10-4+,18-12+/t11-,13+/m0/s1 |
| InChIKey | KMNNNZPPUIQNKG-JYOAHXAVSA-N |
| XLogP | 2.95 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|