C17H18N4 — CID 7336409
(1S,4aR)-2-iminospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,1'-cyclopentane]-1,3,3-tricarbonitrile (PubChem CID 7336409) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is (1S,4aR)-2-iminospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,1'-cyclopentane]-1,3,3-tricarbonitrile.
| Compound Name | (1S,4aR)-2-iminospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,1'-cyclopentane]-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 7336409 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,4aR)-2-iminospiro[4a,5,6,7-tetrahydro-1H-naphthalene-4,1'-cyclopentane]-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCCC[C@H]2C2(CCCC2)C1(C#N)C#N |
| InChI | InChI=1S/C17H18N4/c18-9-13-12-5-1-2-6-14(12)16(7-3-4-8-16)17(10-19,11-20)15(13)21/h5,13-14,21H,1-4,6-8H2/b21-15+/t13-,14+/m0/s1 |
| InChIKey | UIDXUABVOLYJKT-DLUNODDOSA-N |
| XLogP | 3.48 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|