C18H20ClN3O3 — CID 7308868
N-(3-chlorophenyl)-N'-[(E)-4-(furan-2-yl)butan-2-ylideneamino]butanediamide (PubChem CID 7308868) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-[(E)-4-(furan-2-yl)butan-2-ylideneamino]butanediamide.
| Compound Name | N-(3-chlorophenyl)-N'-[(E)-4-(furan-2-yl)butan-2-ylideneamino]butanediamide |
|---|---|
| PubChem CID | 7308868 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(3-chlorophenyl)-N'-[(E)-4-(furan-2-yl)butan-2-ylideneamino]butanediamide |
| SMILES | C/C(CCc1ccco1)=N\NC(=O)CCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-13(7-8-16-6-3-11-25-16)21-22-18(24)10-9-17(23)20-15-5-2-4-14(19)12-15/h2-6,11-12H,7-10H2,1H3,(H,20,23)(H,22,24)/b21-13+ |
| InChIKey | XFPBAUGOFBOZRQ-FYJGNVAPSA-N |
| XLogP | 3.78 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|