C43H66O10 — CID 73091281
methyl 3-acetyloxy-2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-5,23-diene-21-carboxylate (PubChem CID 73091281) has the molecular formula C43H66O10 and a molecular weight of 742.99 g/mol. Its IUPAC name is methyl 3-acetyloxy-2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-5,23-diene-21-carboxylate.
| Compound Name | methyl 3-acetyloxy-2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-5,23-diene-21-carboxylate |
|---|---|
| PubChem CID | 73091281 |
| Molecular Formula | C43H66O10 |
| Molecular Weight | 742.99 g/mol |
| Exact Mass | 742.47 |
| IUPAC Name | methyl 3-acetyloxy-2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-5,23-diene-21-carboxylate |
| SMILES | COC(=O)C12CC(=O)C(C(C)C)CC(=O)C(C)CCCC(C)CC(=O)C1CC(C)=C1CC(OC(C)=O)C(C)(O)C3CCC(C)(O)C(CCC(C)=CC12)O3 |
| InChI | InChI=1S/C43H66O10/c1-24(2)30-21-34(45)27(5)13-11-12-25(3)19-35(46)33-20-28(6)31-22-39(52-29(7)44)42(9,50)38-16-17-41(8,49)37(53-38)15-14-26(4)18-32(31)43(33,23-36(30)47)40(48)51-10/h18,24-25,27,30,32-33,37-39,49-50H,11-17,19-23H2,1-10H3 |
| InChIKey | UROKSVWMMOVQRB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.99 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|