C41H62O8 — CID 162851344
methyl 2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-4,6,23-triene-21-carboxylate (PubChem CID 162851344) has the molecular formula C41H62O8 and a molecular weight of 682.94 g/mol. Its IUPAC name is methyl 2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-4,6,23-triene-21-carboxylate.
| Compound Name | methyl 2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-4,6,23-triene-21-carboxylate |
|---|---|
| PubChem CID | 162851344 |
| Molecular Formula | C41H62O8 |
| Molecular Weight | 682.94 g/mol |
| Exact Mass | 682.44 |
| IUPAC Name | methyl 2,28-dihydroxy-2,6,11,15,24,28-hexamethyl-9,16,19-trioxo-18-propan-2-yl-31-oxatetracyclo[25.3.1.05,22.08,21]hentriaconta-4,6,23-triene-21-carboxylate |
| SMILES | COC(=O)C12CC(=O)C(C(C)C)CC(=O)C(C)CCCC(C)CC(=O)C1C=C(C)C1=CCC(C)(O)C3CCC(C)(O)C(CCC(C)=CC12)O3 |
| InChI | InChI=1S/C41H62O8/c1-24(2)30-22-33(42)27(5)12-10-11-25(3)20-34(43)32-21-28(6)29-15-17-39(7,46)37-16-18-40(8,47)36(49-37)14-13-26(4)19-31(29)41(32,23-35(30)44)38(45)48-9/h15,19,21,24-25,27,30-32,36-37,46-47H,10-14,16-18,20,22-23H2,1-9H3 |
| InChIKey | BAOIEULYBHGOJI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.94 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|