C18H26O4 — CID 73095084
methyl 3-[4-(oxan-2-yloxy)butyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 73095084) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl 3-[4-(oxan-2-yloxy)butyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | methyl 3-[4-(oxan-2-yloxy)butyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 73095084 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl 3-[4-(oxan-2-yloxy)butyl]bicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(CCCCOC2CCCCO2)C2C=CC1C2 |
| InChI | InChI=1S/C18H26O4/c1-20-18(19)17-14-9-8-13(12-14)15(17)6-2-4-10-21-16-7-3-5-11-22-16/h8-9,13-14,16H,2-7,10-12H2,1H3 |
| InChIKey | PHUJESFSALWDPJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|