C18H24N5O4+ — CID 7312471
(7aS)-2-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 7312471) has the molecular formula C18H24N5O4+ and a molecular weight of 374.42 g/mol. Its IUPAC name is (7aS)-2-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aS)-2-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 7312471 |
| Molecular Formula | C18H24N5O4+ |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (7aS)-2-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCN2C(=O)N1CC[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H23N5O4/c24-17-16-2-1-7-21(16)18(25)22(17)13-10-19-8-11-20(12-9-19)14-3-5-15(6-4-14)23(26)27/h3-6,16H,1-2,7-13H2/p+1/t16-/m0/s1 |
| InChIKey | PDOCBLJTWVGXDE-INIZCTEOSA-O |
| XLogP | -0.27 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|