C13H22N2O3 — CID 73128317
2-amino-8-(3-methyl-3,4-dihydro-2H-pyrrol-2-yl)-8-oxooctanoic acid (PubChem CID 73128317) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-amino-8-(3-methyl-3,4-dihydro-2H-pyrrol-2-yl)-8-oxooctanoic acid.
| Compound Name | 2-amino-8-(3-methyl-3,4-dihydro-2H-pyrrol-2-yl)-8-oxooctanoic acid |
|---|---|
| PubChem CID | 73128317 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-amino-8-(3-methyl-3,4-dihydro-2H-pyrrol-2-yl)-8-oxooctanoic acid |
| SMILES | CC1CC=NC1C(=O)CCCCCC(N)C(=O)O |
| InChI | InChI=1S/C13H22N2O3/c1-9-7-8-15-12(9)11(16)6-4-2-3-5-10(14)13(17)18/h8-10,12H,2-7,14H2,1H3,(H,17,18) |
| InChIKey | VJWMTVGRDWAMBN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|