C20H23N7O3 — CID 73130911
N-(cyclopropylmethyl)-6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine (PubChem CID 73130911) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine.
| Compound Name | N-(cyclopropylmethyl)-6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
|---|---|
| PubChem CID | 73130911 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-(cyclopropylmethyl)-6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
| SMILES | c1cn(-c2ccc(Oc3nnnn3C3COC4C(NCC5CC5)COC43)cc2)cn1 |
| InChI | InChI=1S/C20H23N7O3/c1-2-13(1)9-22-16-10-28-19-17(11-29-18(16)19)27-20(23-24-25-27)30-15-5-3-14(4-6-15)26-8-7-21-12-26/h3-8,12-13,16-19,22H,1-2,9-11H2 |
| InChIKey | DTPSUSGKVNVREM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |