C20H21N7O7 — CID 73132427
2-[2-[[6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethoxy]acetic acid (PubChem CID 73132427) has the molecular formula C20H21N7O7 and a molecular weight of 471.43 g/mol. Its IUPAC name is 2-[2-[[6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 73132427 |
| Molecular Formula | C20H21N7O7 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[2-[[6-[5-(4-imidazol-1-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)NC1COC2C1OCC2n1nnnc1Oc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C20H21N7O7/c28-16(9-31-10-17(29)30)22-14-7-32-19-15(8-33-18(14)19)27-20(23-24-25-27)34-13-3-1-12(2-4-13)26-6-5-21-11-26/h1-6,11,14-15,18-19H,7-10H2,(H,22,28)(H,29,30) |
| InChIKey | AHQWOQDXCJRBRE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |