C20H13ClN2O5 — CID 7313393
(1R,8R,9S,13R)-11-(4-chloro-3-nitrophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione (PubChem CID 7313393) has the molecular formula C20H13ClN2O5 and a molecular weight of 396.79 g/mol. Its IUPAC name is (1R,8R,9S,13R)-11-(4-chloro-3-nitrophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione.
| Compound Name | (1R,8R,9S,13R)-11-(4-chloro-3-nitrophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
|---|---|
| PubChem CID | 7313393 |
| Molecular Formula | C20H13ClN2O5 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (1R,8R,9S,13R)-11-(4-chloro-3-nitrophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
| SMILES | O=C1C[C@H]2c3ccccc3[C@H]1[C@H]1C(=O)N(c3ccc(Cl)c([N+](=O)[O-])c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H13ClN2O5/c21-13-6-5-9(7-14(13)23(27)28)22-19(25)17-12-8-15(24)16(18(17)20(22)26)11-4-2-1-3-10(11)12/h1-7,12,16-18H,8H2/t12-,16+,17-,18+/m0/s1 |
| InChIKey | ZXEWWXJSZFWEBU-PSMGESJCSA-N |
| XLogP | 3.21 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|