C18H34N4O3 — CID 73138916
N-[2-(dimethylamino)ethyl]-2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]acetamide (PubChem CID 73138916) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 73138916 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CCC1CN(C(=O)N2CCOCC2)CCC1CC(=O)NCCN(C)C |
| InChI | InChI=1S/C18H34N4O3/c1-4-15-14-22(18(24)21-9-11-25-12-10-21)7-5-16(15)13-17(23)19-6-8-20(2)3/h15-16H,4-14H2,1-3H3,(H,19,23) |
| InChIKey | DYIANAGXBZJLBN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |