C22H33N3O4 — CID 73139173
2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 73139173) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 73139173 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | CCC1CN(C(=O)N2CCOCC2)CCC1CC(=O)NCc1ccccc1OC |
| InChI | InChI=1S/C22H33N3O4/c1-3-17-16-25(22(27)24-10-12-29-13-11-24)9-8-18(17)14-21(26)23-15-19-6-4-5-7-20(19)28-2/h4-7,17-18H,3,8-16H2,1-2H3,(H,23,26) |
| InChIKey | IETOUBYBANEGCF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |