C22H30N6O2S — CID 73148768
N-(2-acetamidoethyl)-6-[[4-(phenylsulfanylmethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 73148768) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-6-[[4-(phenylsulfanylmethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-6-[[4-(phenylsulfanylmethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 73148768 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-(2-acetamidoethyl)-6-[[4-(phenylsulfanylmethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1CN2CCC1CC2Cn1cc(CSc2ccccc2)nn1 |
| InChI | InChI=1S/C22H30N6O2S/c1-16(29)23-8-9-24-22(30)21-14-27-10-7-17(21)11-19(27)13-28-12-18(25-26-28)15-31-20-5-3-2-4-6-20/h2-6,12,17,19,21H,7-11,13-15H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | GGVUMNRVZYUWIY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|