C11H17NO — CID 73155106
2-hydroxy-4,8-dimethylnona-3,7-dienenitrile (PubChem CID 73155106) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-hydroxy-4,8-dimethylnona-3,7-dienenitrile.
| Compound Name | 2-hydroxy-4,8-dimethylnona-3,7-dienenitrile |
|---|---|
| PubChem CID | 73155106 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-hydroxy-4,8-dimethylnona-3,7-dienenitrile |
| SMILES | CC(C)=CCCC(C)=CC(O)C#N |
| InChI | InChI=1S/C11H17NO/c1-9(2)5-4-6-10(3)7-11(13)8-12/h5,7,11,13H,4,6H2,1-3H3 |
| InChIKey | MCEFGDNRDWFCAI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|