C24H21F3N2 — CID 73158076
4-[cyclopropylmethyl(1-naphthalen-2-ylethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 73158076) has the molecular formula C24H21F3N2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[cyclopropylmethyl(1-naphthalen-2-ylethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[cyclopropylmethyl(1-naphthalen-2-ylethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 73158076 |
| Molecular Formula | C24H21F3N2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[cyclopropylmethyl(1-naphthalen-2-ylethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(c1ccc2ccccc2c1)N(CC1CC1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N2/c1-16(19-9-8-18-4-2-3-5-20(18)12-19)29(15-17-6-7-17)22-11-10-21(14-28)23(13-22)24(25,26)27/h2-5,8-13,16-17H,6-7,15H2,1H3 |
| InChIKey | DKECJJCUBGNYJP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |