C15H20N2O4 — CID 73168551
N'-cyclopropyl-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide (PubChem CID 73168551) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 73168551 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N'-cyclopropyl-N-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1cccc(C(CNC(=O)C(=O)NC2CC2)OC)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-12-5-3-4-10(8-12)13(21-2)9-16-14(18)15(19)17-11-6-7-11/h3-5,8,11,13H,6-7,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | RYLZJTXEQVRCEE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|