C38H49F2N2O11S3+ — CID 73173887
6-[4,6-difluoro-3,3-dimethyl-2-[5-[3-methyl-5-sulfo-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]indol-1-ium-1-yl]hexanoic acid (PubChem CID 73173887) has the molecular formula C38H49F2N2O11S3+ and a molecular weight of 844.01 g/mol. Its IUPAC name is 6-[4,6-difluoro-3,3-dimethyl-2-[5-[3-methyl-5-sulfo-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]indol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4,6-difluoro-3,3-dimethyl-2-[5-[3-methyl-5-sulfo-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]indol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 73173887 |
| Molecular Formula | C38H49F2N2O11S3+ |
| Molecular Weight | 844.01 g/mol |
| Exact Mass | 843.25 |
| IUPAC Name | 6-[4,6-difluoro-3,3-dimethyl-2-[5-[3-methyl-5-sulfo-1,3-bis(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]indol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1(C)C(C=CC=CC=C2N(CCCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)CCCCS(=O)(=O)O)=[N+](CCCCCC(=O)O)c2cc(F)cc(F)c21 |
| InChI | InChI=1S/C38H48F2N2O11S3/c1-37(2)33(42(20-10-5-8-16-35(43)44)32-25-27(39)24-30(40)36(32)37)14-6-4-7-15-34-38(3,19-9-12-22-54(45,46)47)29-26-28(56(51,52)53)17-18-31(29)41(34)21-11-13-23-55(48,49)50/h4,6-7,14-15,17-18,24-26H,5,8-13,16,19-23H2,1-3H3,(H3-,43,44,45,46,47,48,49,50,51,52,53)/p+1 |
| InChIKey | JQLFYVPXFLGMQE-UHFFFAOYSA-O |
| XLogP | 6.73 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.01 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|