C22H24N2O4 — CID 7317589
methyl 5-[[1-(2-methoxy-5-methylphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-4-oxopyrrole-3-carboxylate (PubChem CID 7317589) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 5-[[1-(2-methoxy-5-methylphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-4-oxopyrrole-3-carboxylate.
| Compound Name | methyl 5-[[1-(2-methoxy-5-methylphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-4-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7317589 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 5-[[1-(2-methoxy-5-methylphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-4-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C(Cc2cc(C)n(-c3cc(C)ccc3OC)c2C)C1=O |
| InChI | InChI=1S/C22H24N2O4/c1-12-7-8-19(27-5)18(9-12)24-13(2)10-16(15(24)4)11-17-21(25)20(14(3)23-17)22(26)28-6/h7-10H,11H2,1-6H3 |
| InChIKey | GVZCICOQYNIFQP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|