C16H25NS — CID 73184989
1-isothiocyanato-1-methyl-4-(6-methylhepta-2,4-dien-2-yl)cyclohexane (PubChem CID 73184989) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 1-isothiocyanato-1-methyl-4-(6-methylhepta-2,4-dien-2-yl)cyclohexane.
| Compound Name | 1-isothiocyanato-1-methyl-4-(6-methylhepta-2,4-dien-2-yl)cyclohexane |
|---|---|
| PubChem CID | 73184989 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-isothiocyanato-1-methyl-4-(6-methylhepta-2,4-dien-2-yl)cyclohexane |
| SMILES | CC(=CC=CC(C)C)C1CCC(C)(N=C=S)CC1 |
| InChI | InChI=1S/C16H25NS/c1-13(2)6-5-7-14(3)15-8-10-16(4,11-9-15)17-12-18/h5-7,13,15H,8-11H2,1-4H3 |
| InChIKey | ODKXKBHVDFQUQQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|