C18H27NS — CID 154488987
2-ethyl-5-isothiocyanato-5-(4-propylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 154488987) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is 2-ethyl-5-isothiocyanato-5-(4-propylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 2-ethyl-5-isothiocyanato-5-(4-propylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154488987 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 2-ethyl-5-isothiocyanato-5-(4-propylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | CCCC1CCC(C2(N=C=S)C=CC(CC)=CC2)CC1 |
| InChI | InChI=1S/C18H27NS/c1-3-5-16-6-8-17(9-7-16)18(19-14-20)12-10-15(4-2)11-13-18/h10-12,16-17H,3-9,13H2,1-2H3 |
| InChIKey | BPQQQRUQYCMIKQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|