C17H22N2O4 — CID 73192995
dimethyl 1-benzyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate (PubChem CID 73192995) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is dimethyl 1-benzyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate |
|---|---|
| PubChem CID | 73192995 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | dimethyl 1-benzyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate |
| SMILES | COC(=O)C1CC(C(=O)OC)N2CCN(Cc3ccccc3)C12 |
| InChI | InChI=1S/C17H22N2O4/c1-22-16(20)13-10-14(17(21)23-2)19-9-8-18(15(13)19)11-12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3 |
| InChIKey | NXQNUMJIOUHMPK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |