C20H23ClN2O2 — CID 7321085
(3R)-N-benzyl-N'-(3-chloro-4-methylphenyl)-3-methylpentanediamide (PubChem CID 7321085) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is (3R)-N-benzyl-N'-(3-chloro-4-methylphenyl)-3-methylpentanediamide.
| Compound Name | (3R)-N-benzyl-N'-(3-chloro-4-methylphenyl)-3-methylpentanediamide |
|---|---|
| PubChem CID | 7321085 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3R)-N-benzyl-N'-(3-chloro-4-methylphenyl)-3-methylpentanediamide |
| SMILES | Cc1ccc(NC(=O)C[C@H](C)CC(=O)NCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O2/c1-14(10-19(24)22-13-16-6-4-3-5-7-16)11-20(25)23-17-9-8-15(2)18(21)12-17/h3-9,12,14H,10-11,13H2,1-2H3,(H,22,24)(H,23,25)/t14-/m1/s1 |
| InChIKey | SXVRGYSFQTZPFO-CQSZACIVSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |