C17H22ClN3O3 — CID 7321134
(3Z)-3-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]-N-[[(2R)-oxolan-2-yl]methyl]butanamide (PubChem CID 7321134) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is (3Z)-3-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]-N-[[(2R)-oxolan-2-yl]methyl]butanamide.
| Compound Name | (3Z)-3-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 7321134 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (3Z)-3-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
| SMILES | C/C(CC(=O)NC[C@H]1CCCO1)=N/NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-12(9-16(22)19-11-15-3-2-8-24-15)20-21-17(23)10-13-4-6-14(18)7-5-13/h4-7,15H,2-3,8-11H2,1H3,(H,19,22)(H,21,23)/b20-12-/t15-/m1/s1 |
| InChIKey | GKYSILXFCJEMGC-GEYIUBJWSA-N |
| XLogP | 2.06 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|