C16H21N3O5 — CID 171980726
2,4-dihydroxy-N-[(E)-[4-oxo-4-(oxolan-2-ylmethylamino)butan-2-ylidene]amino]benzamide (PubChem CID 171980726) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2,4-dihydroxy-N-[(E)-[4-oxo-4-(oxolan-2-ylmethylamino)butan-2-ylidene]amino]benzamide.
| Compound Name | 2,4-dihydroxy-N-[(E)-[4-oxo-4-(oxolan-2-ylmethylamino)butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 171980726 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2,4-dihydroxy-N-[(E)-[4-oxo-4-(oxolan-2-ylmethylamino)butan-2-ylidene]amino]benzamide |
| SMILES | C/C(CC(=O)NCC1CCCO1)=N\NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H21N3O5/c1-10(7-15(22)17-9-12-3-2-6-24-12)18-19-16(23)13-5-4-11(20)8-14(13)21/h4-5,8,12,20-21H,2-3,6-7,9H2,1H3,(H,17,22)(H,19,23)/b18-10+ |
| InChIKey | JYDVUSASBLKPBJ-VCHYOVAHSA-N |
| XLogP | 0.89 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|