C9H6Cl2N2O3S — CID 73212123
2-(3,4-dichlorophenyl)-5-methylsulfonyl-1,3,4-oxadiazole (PubChem CID 73212123) has the molecular formula C9H6Cl2N2O3S and a molecular weight of 293.13 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-methylsulfonyl-1,3,4-oxadiazole.
| Compound Name | 2-(3,4-dichlorophenyl)-5-methylsulfonyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 73212123 |
| Molecular Formula | C9H6Cl2N2O3S |
| Molecular Weight | 293.13 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-methylsulfonyl-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)c1nnc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C9H6Cl2N2O3S/c1-17(14,15)9-13-12-8(16-9)5-2-3-6(10)7(11)4-5/h2-4H,1H3 |
| InChIKey | UKRLQLPNHSYKHX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |