C34H36N2O2 — CID 73212894
CID 73212894 (PubChem CID 73212894) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol.
| Compound Name | CID 73212894 |
|---|---|
| PubChem CID | 73212894 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | — |
| SMILES | NC(=O)CCCCCCC(=O)Nc1ccc(/C(=C(/CC[C]2[CH][CH][CH][CH]2)[C]2[CH][CH][CH][CH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N2O2/c35-32(37)18-6-1-2-7-19-33(38)36-30-23-21-29(22-24-30)34(28-16-4-3-5-17-28)31(27-14-10-11-15-27)25-20-26-12-8-9-13-26/h3-5,8-17,21-24H,1-2,6-7,18-20,25H2,(H2,35,37)(H,36,38)/b34-31- |
| InChIKey | PKPJPTMWSAOFEB-NMSHJFGGSA-N |
| XLogP | 6.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|