About CID 53376739
CID 53376739 (PubChem CID 53376739) has the molecular formula C24H24NO
and a molecular weight of 342.46 g/mol.
Molecular Properties
| Compound Name | CID 53376739 |
| PubChem CID | 53376739 |
| Molecular Formula | C24H24NO |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | — |
| SMILES | CCC(=O)Nc1ccc(/C(=C(/CC)[C]2[CH][CH][CH][CH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24NO/c1-3-22(18-10-8-9-11-18)24(19-12-6-5-7-13-19)20-14-16-21(17-15-20)25-23(26)4-2/h5-17H,3-4H2,1-2H3,(H,25,26)/b24-22- |
| InChIKey | FQEOVOJBBOOAED-GYHWCHFESA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 53376739 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53376739?
The IUPAC name of CID 53376739 (CID 53376739) is not available.
What is the SMILES notation for CID 53376739?
The canonical SMILES for CID 53376739 is CCC(=O)Nc1ccc(/C(=C(/CC)[C]2[CH][CH][CH][CH]2)c2ccccc2)cc1.
What is the InChIKey of CID 53376739?
The InChIKey is FQEOVOJBBOOAED-GYHWCHFESA-N. The full InChI is InChI=1S/C24H24NO/c1-3-22(18-10-8-9-11-18)24(19-12-6-5-7-13-19)20-14-16-21(17-15-20)25-23(26)4-2/h5-17H,3-4H2,1-2H3,(H,25,26)/b24-22-.
What are the key properties of CID 53376739?
CID 53376739 has a molecular weight of 342.46 g/mol, XLogP of 5.65, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53376739 is sourced from PubChem (CID 53376739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).