About CID 24881342
CID 24881342 (PubChem CID 24881342) has the molecular formula C23H23S2
and a molecular weight of 363.57 g/mol.
Molecular Properties
| Compound Name | CID 24881342 |
| PubChem CID | 24881342 |
| Molecular Formula | C23H23S2 |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | — |
| SMILES | CCC([C]1[CH][CH][CH][CH]1)=C(c1ccc(SC)cc1)c1ccc(SC)cc1 |
| InChI | InChI=1S/C23H23S2/c1-4-22(17-7-5-6-8-17)23(18-9-13-20(24-2)14-10-18)19-11-15-21(25-3)16-12-19/h5-16H,4H2,1-3H3 |
| InChIKey | GSWMXEDWEVNZBP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 24881342 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24881342?
The IUPAC name of CID 24881342 (CID 24881342) is not available.
What is the SMILES notation for CID 24881342?
The canonical SMILES for CID 24881342 is CCC([C]1[CH][CH][CH][CH]1)=C(c1ccc(SC)cc1)c1ccc(SC)cc1.
What is the InChIKey of CID 24881342?
The InChIKey is GSWMXEDWEVNZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23S2/c1-4-22(17-7-5-6-8-17)23(18-9-13-20(24-2)14-10-18)19-11-15-21(25-3)16-12-19/h5-16H,4H2,1-3H3.
What are the key properties of CID 24881342?
CID 24881342 has a molecular weight of 363.57 g/mol, XLogP of 6.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24881342 is sourced from PubChem (CID 24881342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).