C19H27BrN4O3 — CID 73215632
4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-(diethylamino)propyl]butanamide (PubChem CID 73215632) has the molecular formula C19H27BrN4O3 and a molecular weight of 439.35 g/mol. Its IUPAC name is 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-(diethylamino)propyl]butanamide.
| Compound Name | 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-(diethylamino)propyl]butanamide |
|---|---|
| PubChem CID | 73215632 |
| Molecular Formula | C19H27BrN4O3 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-(6-bromo-2,4-dioxo-4aH-quinazolin-3-yl)-N-[3-(diethylamino)propyl]butanamide |
| SMILES | CCN(CC)CCCNC(=O)CCCN1C(=O)N=C2C=CC(Br)=CC2C1=O |
| InChI | InChI=1S/C19H27BrN4O3/c1-3-23(4-2)11-6-10-21-17(25)7-5-12-24-18(26)15-13-14(20)8-9-16(15)22-19(24)27/h8-9,13,15H,3-7,10-12H2,1-2H3,(H,21,25) |
| InChIKey | IXPKURRVHIIOQT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|