C13H19N3O4S — CID 73215723
methyl 3-[(4-ethylphenyl)sulfamoyl]pyrazolidine-4-carboxylate (PubChem CID 73215723) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 3-[(4-ethylphenyl)sulfamoyl]pyrazolidine-4-carboxylate.
| Compound Name | methyl 3-[(4-ethylphenyl)sulfamoyl]pyrazolidine-4-carboxylate |
|---|---|
| PubChem CID | 73215723 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 3-[(4-ethylphenyl)sulfamoyl]pyrazolidine-4-carboxylate |
| SMILES | CCc1ccc(NS(=O)(=O)C2NNCC2C(=O)OC)cc1 |
| InChI | InChI=1S/C13H19N3O4S/c1-3-9-4-6-10(7-5-9)16-21(18,19)12-11(8-14-15-12)13(17)20-2/h4-7,11-12,14-16H,3,8H2,1-2H3 |
| InChIKey | NZUASKNGBNCXKS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |