C34H44N4O4 — CID 73216260
4-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]-N-(2-phenylethyl)cyclohexane-1-carboxamide (PubChem CID 73216260) has the molecular formula C34H44N4O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is 4-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]-N-(2-phenylethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]-N-(2-phenylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 73216260 |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 4-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]-N-(2-phenylethyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1C(=O)N(CC2CCC(C(=O)NCCc3ccccc3)CC2)C(=O)C2CCCCC21 |
| InChI | InChI=1S/C34H44N4O4/c1-23-9-8-10-24(2)31(23)36-30(39)22-37-29-14-7-6-13-28(29)33(41)38(34(37)42)21-26-15-17-27(18-16-26)32(40)35-20-19-25-11-4-3-5-12-25/h3-5,8-12,26-29H,6-7,13-22H2,1-2H3,(H,35,40)(H,36,39) |
| InChIKey | FMKZMGGEYRSKCA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |