C25H22N3O6S+ — CID 73219732
N-(3,5-dimethoxyphenyl)-2-[3-(furan-2-ylmethyl)-2,4-dioxo-4aH-[1]benzothiolo[3,2-d]pyrimidin-1-ium-1-yl]acetamide (PubChem CID 73219732) has the molecular formula C25H22N3O6S+ and a molecular weight of 492.53 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[3-(furan-2-ylmethyl)-2,4-dioxo-4aH-[1]benzothiolo[3,2-d]pyrimidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[3-(furan-2-ylmethyl)-2,4-dioxo-4aH-[1]benzothiolo[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 73219732 |
| Molecular Formula | C25H22N3O6S+ |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[3-(furan-2-ylmethyl)-2,4-dioxo-4aH-[1]benzothiolo[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
| SMILES | COc1cc(NC(=O)C[N+]2=C3c4ccccc4SC3C(=O)N(Cc3ccco3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C25H21N3O6S/c1-32-17-10-15(11-18(12-17)33-2)26-21(29)14-27-22-19-7-3-4-8-20(19)35-23(22)24(30)28(25(27)31)13-16-6-5-9-34-16/h3-12,23H,13-14H2,1-2H3/p+1 |
| InChIKey | ANOUWXKQJGZLCH-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|