C16H16Cl2N5O3S+ — CID 73222078
N-(2,5-dichlorophenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide (PubChem CID 73222078) has the molecular formula C16H16Cl2N5O3S+ and a molecular weight of 429.31 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 73222078 |
| Molecular Formula | C16H16Cl2N5O3S+ |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide |
| SMILES | CN1C(=O)C2N=C(SCC(=O)Nc3cc(Cl)ccc3Cl)[N+](C)=C2N(C)C1=O |
| InChI | InChI=1S/C16H15Cl2N5O3S/c1-21-13-12(14(25)23(3)16(26)22(13)2)20-15(21)27-7-11(24)19-10-6-8(17)4-5-9(10)18/h4-6,12H,7H2,1-3H3/p+1 |
| InChIKey | LAHAAASFKFLRLL-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|