C18H22N5O4S+ — CID 78468980
N-(2-ethoxyphenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide (PubChem CID 78468980) has the molecular formula C18H22N5O4S+ and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 78468980 |
| Molecular Formula | C18H22N5O4S+ |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[(1,3,9-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)sulfanyl]acetamide |
| SMILES | CCOc1ccccc1NC(=O)CSC1=NC2C(=O)N(C)C(=O)N(C)C2=[N+]1C |
| InChI | InChI=1S/C18H21N5O4S/c1-5-27-12-9-7-6-8-11(12)19-13(24)10-28-17-20-14-15(21(17)2)22(3)18(26)23(4)16(14)25/h6-9,14H,5,10H2,1-4H3/p+1 |
| InChIKey | GICPOIIKPMVYLB-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|