C13H18Cl3N2O+ — CID 7322574
propan-2-yl-[(1S)-2,2,2-trichloro-1-[(2-phenylacetyl)amino]ethyl]azanium (PubChem CID 7322574) has the molecular formula C13H18Cl3N2O+ and a molecular weight of 324.66 g/mol. Its IUPAC name is propan-2-yl-[(1S)-2,2,2-trichloro-1-[(2-phenylacetyl)amino]ethyl]azanium.
| Compound Name | propan-2-yl-[(1S)-2,2,2-trichloro-1-[(2-phenylacetyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7322574 |
| Molecular Formula | C13H18Cl3N2O+ |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | propan-2-yl-[(1S)-2,2,2-trichloro-1-[(2-phenylacetyl)amino]ethyl]azanium |
| SMILES | CC(C)[NH2+][C@H](NC(=O)Cc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H17Cl3N2O/c1-9(2)17-12(13(14,15)16)18-11(19)8-10-6-4-3-5-7-10/h3-7,9,12,17H,8H2,1-2H3,(H,18,19)/p+1/t12-/m1/s1 |
| InChIKey | RVRIAONMWINUPS-GFCCVEGCSA-O |
| XLogP | 2.01 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|