C14H13Na3O5 — CID 73230716
trisodium;2-[(4-oxidophenyl)methyl]-3-propan-2-ylbut-2-enedioate (PubChem CID 73230716) has the molecular formula C14H13Na3O5 and a molecular weight of 330.22 g/mol. Its IUPAC name is trisodium;2-[(4-oxidophenyl)methyl]-3-propan-2-ylbut-2-enedioate.
| Compound Name | trisodium;2-[(4-oxidophenyl)methyl]-3-propan-2-ylbut-2-enedioate |
|---|---|
| PubChem CID | 73230716 |
| Molecular Formula | C14H13Na3O5 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | trisodium;2-[(4-oxidophenyl)methyl]-3-propan-2-ylbut-2-enedioate |
| SMILES | CC(C)C(C(=O)[O-])=C(Cc1ccc([O-])cc1)C(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C14H16O5.3Na/c1-8(2)12(14(18)19)11(13(16)17)7-9-3-5-10(15)6-4-9;;;/h3-6,8,15H,7H2,1-2H3,(H,16,17)(H,18,19);;;/q;3*+1/p-3 |
| InChIKey | KGAULUQEEXPJMQ-UHFFFAOYSA-K |
| XLogP | -10.23 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | -10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|