C15H15NNa2O5 — CID 59706498
disodium;(Z)-2-[(4-carbamoylphenyl)methyl]-3-propan-2-ylbut-2-enedioate (PubChem CID 59706498) has the molecular formula C15H15NNa2O5 and a molecular weight of 335.27 g/mol. Its IUPAC name is disodium;(Z)-2-[(4-carbamoylphenyl)methyl]-3-propan-2-ylbut-2-enedioate.
| Compound Name | disodium;(Z)-2-[(4-carbamoylphenyl)methyl]-3-propan-2-ylbut-2-enedioate |
|---|---|
| PubChem CID | 59706498 |
| Molecular Formula | C15H15NNa2O5 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | disodium;(Z)-2-[(4-carbamoylphenyl)methyl]-3-propan-2-ylbut-2-enedioate |
| SMILES | CC(C)/C(C(=O)[O-])=C(\Cc1ccc(C(N)=O)cc1)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C15H17NO5.2Na/c1-8(2)12(15(20)21)11(14(18)19)7-9-3-5-10(6-4-9)13(16)17;;/h3-6,8H,7H2,1-2H3,(H2,16,17)(H,18,19)(H,20,21);;/q;2*+1/p-2/b12-11-;; |
| InChIKey | AGPIDUROJVQOSK-IPEZHVIRSA-L |
| XLogP | -7.21 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | -7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|