C9H18O7S3 — CID 73241622
2-(hydroxymethyl)-6-(methylsulfonylmethylsulfanylmethylsulfanyl)oxane-3,4,5-triol (PubChem CID 73241622) has the molecular formula C9H18O7S3 and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(methylsulfonylmethylsulfanylmethylsulfanyl)oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(methylsulfonylmethylsulfanylmethylsulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 73241622 |
| Molecular Formula | C9H18O7S3 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-(hydroxymethyl)-6-(methylsulfonylmethylsulfanylmethylsulfanyl)oxane-3,4,5-triol |
| SMILES | CS(=O)(=O)CSCSC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C9H18O7S3/c1-19(14,15)4-17-3-18-9-8(13)7(12)6(11)5(2-10)16-9/h5-13H,2-4H2,1H3 |
| InChIKey | UOVYZWJIGBAQCP-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|