C24H32N2O4 — CID 73243636
1-(adamantane-1-carbonyl)-4-hydroxy-N-[(2-methoxyphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 73243636) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-4-hydroxy-N-[(2-methoxyphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(adamantane-1-carbonyl)-4-hydroxy-N-[(2-methoxyphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 73243636 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-4-hydroxy-N-[(2-methoxyphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccccc1CNC(=O)C1CC(O)CN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O4/c1-30-21-5-3-2-4-18(21)13-25-22(28)20-9-19(27)14-26(20)23(29)24-10-15-6-16(11-24)8-17(7-15)12-24/h2-5,15-17,19-20,27H,6-14H2,1H3,(H,25,28) |
| InChIKey | QZJWKGNUMQTKKJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |