C25H34N2O3 — CID 55343704
1-(adamantane-1-carbonyl)-N-[(2-methoxyphenyl)methyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 55343704) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-N-[(2-methoxyphenyl)methyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(adamantane-1-carbonyl)-N-[(2-methoxyphenyl)methyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55343704 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-N-[(2-methoxyphenyl)methyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | COc1ccccc1CN(C)C(=O)C1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H34N2O3/c1-26(16-20-6-3-4-8-22(20)30-2)23(28)21-7-5-9-27(21)24(29)25-13-17-10-18(14-25)12-19(11-17)15-25/h3-4,6,8,17-19,21H,5,7,9-16H2,1-2H3 |
| InChIKey | RJEOYBANQWOZOV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |