C19H18N2O4 — CID 7325095
(3S)-2-(2-hydroxyethylimino)-3-(3-methoxyanilino)naphthalene-1,4-dione (PubChem CID 7325095) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3S)-2-(2-hydroxyethylimino)-3-(3-methoxyanilino)naphthalene-1,4-dione.
| Compound Name | (3S)-2-(2-hydroxyethylimino)-3-(3-methoxyanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 7325095 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (3S)-2-(2-hydroxyethylimino)-3-(3-methoxyanilino)naphthalene-1,4-dione |
| SMILES | COc1cccc(N[C@@H]2C(=O)c3ccccc3C(=O)/C2=N\CCO)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-25-13-6-4-5-12(11-13)21-17-16(20-9-10-22)18(23)14-7-2-3-8-15(14)19(17)24/h2-8,11,17,21-22H,9-10H2,1H3/b20-16-/t17-/m0/s1 |
| InChIKey | XFWVCLZGXVOTDY-IMGOXIFKSA-N |
| XLogP | 1.99 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|