C8H12N4O4 — CID 73255469
7-(2,3-dihydroxypropyl)-4,5-dihydro-3H-purine-2,6-dione (PubChem CID 73255469) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-4,5-dihydro-3H-purine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-4,5-dihydro-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 73255469 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-4,5-dihydro-3H-purine-2,6-dione |
| SMILES | O=C1NC(=O)C2C(N=CN2CC(O)CO)N1 |
| InChI | InChI=1S/C8H12N4O4/c13-2-4(14)1-12-3-9-6-5(12)7(15)11-8(16)10-6/h3-6,13-14H,1-2H2,(H2,10,11,15,16) |
| InChIKey | NRPLFGOTUPUFKI-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |