C10H17N4O3+ — CID 7786090
(4R,5R)-7-(3-hydroxypropyl)-1,3-dimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione (PubChem CID 7786090) has the molecular formula C10H17N4O3+ and a molecular weight of 241.27 g/mol. Its IUPAC name is (4R,5R)-7-(3-hydroxypropyl)-1,3-dimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione.
| Compound Name | (4R,5R)-7-(3-hydroxypropyl)-1,3-dimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 7786090 |
| Molecular Formula | C10H17N4O3+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (4R,5R)-7-(3-hydroxypropyl)-1,3-dimethyl-5,9-dihydro-4H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](NC=[N+]2CCCO)N(C)C1=O |
| InChI | InChI=1S/C10H16N4O3/c1-12-8-7(9(16)13(2)10(12)17)14(6-11-8)4-3-5-15/h6-8,15H,3-5H2,1-2H3/p+1/t7-,8-/m1/s1 |
| InChIKey | PJKXZFSJQOSIMO-HTQZYQBOSA-O |
| XLogP | -1.77 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|