C6H8N4O2 — CID 71304053
7-methyl-4,5-dihydro-3H-purine-2,6-dione (PubChem CID 71304053) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 7-methyl-4,5-dihydro-3H-purine-2,6-dione.
| Compound Name | 7-methyl-4,5-dihydro-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 71304053 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 7-methyl-4,5-dihydro-3H-purine-2,6-dione |
| SMILES | CN1C=NC2NC(=O)NC(=O)C21 |
| InChI | InChI=1S/C6H8N4O2/c1-10-2-7-4-3(10)5(11)9-6(12)8-4/h2-4H,1H3,(H2,8,9,11,12) |
| InChIKey | RVNBZBLNDMYZEV-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |