C28H32N2O4 — CID 73256801
11-[2-[(4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl)oxy]ethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 73256801) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 11-[2-[(4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl)oxy]ethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[2-[(4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl)oxy]ethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 73256801 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 11-[2-[(4-oxo-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-7-yl)oxy]ethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C1C(c2ccccc2)=COC2CC(OCCN3CC4CC(C3)c3cccc(=O)n3C4)CCC12 |
| InChI | InChI=1S/C28H32N2O4/c31-27-8-4-7-25-21-13-19(16-30(25)27)15-29(17-21)11-12-33-22-9-10-23-26(14-22)34-18-24(28(23)32)20-5-2-1-3-6-20/h1-8,18-19,21-23,26H,9-17H2 |
| InChIKey | FDIDRRORXMFSGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |