C15H17N4O2S+ — CID 7325990
(3S)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7325990) has the molecular formula C15H17N4O2S+ and a molecular weight of 317.39 g/mol. Its IUPAC name is (3S)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7325990 |
| Molecular Formula | C15H17N4O2S+ |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (3S)-3-[4-(1,3-benzothiazol-2-yl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CCN(c3nc4ccccc4s3)CC2)C(=O)N1 |
| InChI | InChI=1S/C15H16N4O2S/c20-13-9-11(14(21)17-13)18-5-7-19(8-6-18)15-16-10-3-1-2-4-12(10)22-15/h1-4,11H,5-9H2,(H,17,20,21)/p+1/t11-/m0/s1 |
| InChIKey | UWGCHUFCLBTXLT-NSHDSACASA-O |
| XLogP | -0.58 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|