C18H21N3O2S — CID 73263536
6-benzyl-3-(2-phenoxyethylsulfanyl)-1,2,4-triazinan-5-one (PubChem CID 73263536) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 6-benzyl-3-(2-phenoxyethylsulfanyl)-1,2,4-triazinan-5-one.
| Compound Name | 6-benzyl-3-(2-phenoxyethylsulfanyl)-1,2,4-triazinan-5-one |
|---|---|
| PubChem CID | 73263536 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 6-benzyl-3-(2-phenoxyethylsulfanyl)-1,2,4-triazinan-5-one |
| SMILES | O=C1NC(SCCOc2ccccc2)NNC1Cc1ccccc1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17-16(13-14-7-3-1-4-8-14)20-21-18(19-17)24-12-11-23-15-9-5-2-6-10-15/h1-10,16,18,20-21H,11-13H2,(H,19,22) |
| InChIKey | IKDGJAGCTUIVIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|