C23H17N2O4- — CID 7326870
3-[5-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]-4-methylbenzoate (PubChem CID 7326870) has the molecular formula C23H17N2O4- and a molecular weight of 385.40 g/mol. Its IUPAC name is 3-[5-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]-4-methylbenzoate.
| Compound Name | 3-[5-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 7326870 |
| Molecular Formula | C23H17N2O4- |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-[5-[(E)-2-cyano-3-(2-methylanilino)-3-oxoprop-1-enyl]furan-2-yl]-4-methylbenzoate |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C/c1ccc(-c2cc(C(=O)[O-])ccc2C)o1 |
| InChI | InChI=1S/C23H18N2O4/c1-14-7-8-16(23(27)28)12-19(14)21-10-9-18(29-21)11-17(13-24)22(26)25-20-6-4-3-5-15(20)2/h3-12H,1-2H3,(H,25,26)(H,27,28)/p-1/b17-11+ |
| InChIKey | BMJFQNNKXKYOQP-GZTJUZNOSA-M |
| XLogP | 3.47 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|