C11H12N2OS — CID 7326891
(E)-2-cyano-N,N-dimethyl-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 7326891) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is (E)-2-cyano-N,N-dimethyl-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N,N-dimethyl-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7326891 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (E)-2-cyano-N,N-dimethyl-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1/C=C(\C#N)C(=O)N(C)C |
| InChI | InChI=1S/C11H12N2OS/c1-8-4-5-15-10(8)6-9(7-12)11(14)13(2)3/h4-6H,1-3H3/b9-6+ |
| InChIKey | CXNGTVODVBHBDY-RMKNXTFCSA-N |
| XLogP | 2.05 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|